C20H20O6S — CID 70218942
(Z)-3-ethoxycarbonyl-4-(4-methylsulfonylphenyl)-4-phenylbut-2-enoic acid (PubChem CID 70218942) has the molecular formula C20H20O6S and a molecular weight of 388.44 g/mol. Its IUPAC name is (Z)-3-ethoxycarbonyl-4-(4-methylsulfonylphenyl)-4-phenylbut-2-enoic acid.
| Compound Name | (Z)-3-ethoxycarbonyl-4-(4-methylsulfonylphenyl)-4-phenylbut-2-enoic acid |
|---|---|
| PubChem CID | 70218942 |
| Molecular Formula | C20H20O6S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (Z)-3-ethoxycarbonyl-4-(4-methylsulfonylphenyl)-4-phenylbut-2-enoic acid |
| SMILES | CCOC(=O)/C(=C\C(=O)O)C(c1ccccc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H20O6S/c1-3-26-20(23)17(13-18(21)22)19(14-7-5-4-6-8-14)15-9-11-16(12-10-15)27(2,24)25/h4-13,19H,3H2,1-2H3,(H,21,22)/b17-13- |
| InChIKey | RAIUYSACALNAFK-LGMDPLHJSA-N |
| XLogP | 2.80 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|