C21H20N4O2S — CID 70221915
ethyl 2-[7-amino-2-(6-methyl-2-pyridinyl)-1H-indol-5-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 70221915) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is ethyl 2-[7-amino-2-(6-methyl-2-pyridinyl)-1H-indol-5-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[7-amino-2-(6-methyl-2-pyridinyl)-1H-indol-5-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 70221915 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | ethyl 2-[7-amino-2-(6-methyl-2-pyridinyl)-1H-indol-5-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2cc(N)c3[nH]c(-c4cccc(C)n4)cc3c2)nc1C |
| InChI | InChI=1S/C21H20N4O2S/c1-4-27-21(26)19-12(3)24-20(28-19)14-8-13-10-17(25-18(13)15(22)9-14)16-7-5-6-11(2)23-16/h5-10,25H,4,22H2,1-3H3 |
| InChIKey | ZKOFTXFXZOLHDB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|