C19H18F3N3O4 — CID 70222130
5-[(E,1R)-1-amino-2-methoxycarbonyl-3-[3-(trifluoromethyl)anilino]but-2-enyl]pyridine-2-carboxylic acid (PubChem CID 70222130) has the molecular formula C19H18F3N3O4 and a molecular weight of 409.36 g/mol. Its IUPAC name is 5-[(E,1R)-1-amino-2-methoxycarbonyl-3-[3-(trifluoromethyl)anilino]but-2-enyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[(E,1R)-1-amino-2-methoxycarbonyl-3-[3-(trifluoromethyl)anilino]but-2-enyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 70222130 |
| Molecular Formula | C19H18F3N3O4 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5-[(E,1R)-1-amino-2-methoxycarbonyl-3-[3-(trifluoromethyl)anilino]but-2-enyl]pyridine-2-carboxylic acid |
| SMILES | COC(=O)/C(=C(\C)Nc1cccc(C(F)(F)F)c1)[C@H](N)c1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C19H18F3N3O4/c1-10(25-13-5-3-4-12(8-13)19(20,21)22)15(18(28)29-2)16(23)11-6-7-14(17(26)27)24-9-11/h3-9,16,25H,23H2,1-2H3,(H,26,27)/b15-10+/t16-/m1/s1 |
| InChIKey | AZZASAFCYWMKHR-AAGJOFLKSA-N |
| XLogP | 3.36 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|