C21H32N2O7S — CID 70222706
methyl (E)-4-[4-[2-[[(2S)-2-(ethylsulfonylamino)-3-methylbutanoyl]amino]ethyl]-2-methoxyphenoxy]but-2-enoate (PubChem CID 70222706) has the molecular formula C21H32N2O7S and a molecular weight of 456.56 g/mol. Its IUPAC name is methyl (E)-4-[4-[2-[[(2S)-2-(ethylsulfonylamino)-3-methylbutanoyl]amino]ethyl]-2-methoxyphenoxy]but-2-enoate.
| Compound Name | methyl (E)-4-[4-[2-[[(2S)-2-(ethylsulfonylamino)-3-methylbutanoyl]amino]ethyl]-2-methoxyphenoxy]but-2-enoate |
|---|---|
| PubChem CID | 70222706 |
| Molecular Formula | C21H32N2O7S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | methyl (E)-4-[4-[2-[[(2S)-2-(ethylsulfonylamino)-3-methylbutanoyl]amino]ethyl]-2-methoxyphenoxy]but-2-enoate |
| SMILES | CCS(=O)(=O)N[C@H](C(=O)NCCc1ccc(OC/C=C/C(=O)OC)c(OC)c1)C(C)C |
| InChI | InChI=1S/C21H32N2O7S/c1-6-31(26,27)23-20(15(2)3)21(25)22-12-11-16-9-10-17(18(14-16)28-4)30-13-7-8-19(24)29-5/h7-10,14-15,20,23H,6,11-13H2,1-5H3,(H,22,25)/b8-7+/t20-/m0/s1 |
| InChIKey | RWXLNNYKTAQQLJ-DUIUGDAFSA-N |
| XLogP | 1.43 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|