C23H30N2O5S2 — CID 22898924
2-(ethylsulfonylamino)-N-[2-[3-methoxy-4-(3-thiophen-2-ylprop-2-ynoxy)phenyl]ethyl]-3-methylbutanamide (PubChem CID 22898924) has the molecular formula C23H30N2O5S2 and a molecular weight of 478.64 g/mol. Its IUPAC name is 2-(ethylsulfonylamino)-N-[2-[3-methoxy-4-(3-thiophen-2-ylprop-2-ynoxy)phenyl]ethyl]-3-methylbutanamide.
| Compound Name | 2-(ethylsulfonylamino)-N-[2-[3-methoxy-4-(3-thiophen-2-ylprop-2-ynoxy)phenyl]ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 22898924 |
| Molecular Formula | C23H30N2O5S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2-(ethylsulfonylamino)-N-[2-[3-methoxy-4-(3-thiophen-2-ylprop-2-ynoxy)phenyl]ethyl]-3-methylbutanamide |
| SMILES | CCS(=O)(=O)NC(C(=O)NCCc1ccc(OCC#Cc2cccs2)c(OC)c1)C(C)C |
| InChI | InChI=1S/C23H30N2O5S2/c1-5-32(27,28)25-22(17(2)3)23(26)24-13-12-18-10-11-20(21(16-18)29-4)30-14-6-8-19-9-7-15-31-19/h7,9-11,15-17,22,25H,5,12-14H2,1-4H3,(H,24,26) |
| InChIKey | PZCGMTXHRAJCKR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|