C24H29ClN2O5S — CID 155012490
[[(2S)-1-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethylamino]-3-methyl-1-oxobutan-2-yl]amino]methanesulfinic acid (PubChem CID 155012490) has the molecular formula C24H29ClN2O5S and a molecular weight of 493.03 g/mol. Its IUPAC name is [[(2S)-1-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethylamino]-3-methyl-1-oxobutan-2-yl]amino]methanesulfinic acid.
| Compound Name | [[(2S)-1-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethylamino]-3-methyl-1-oxobutan-2-yl]amino]methanesulfinic acid |
|---|---|
| PubChem CID | 155012490 |
| Molecular Formula | C24H29ClN2O5S |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [[(2S)-1-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethylamino]-3-methyl-1-oxobutan-2-yl]amino]methanesulfinic acid |
| SMILES | COc1cc(CCNC(=O)[C@@H](NCS(=O)O)C(C)C)ccc1OCC#Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H29ClN2O5S/c1-17(2)23(27-16-33(29)30)24(28)26-13-12-19-8-11-21(22(15-19)31-3)32-14-4-5-18-6-9-20(25)10-7-18/h6-11,15,17,23,27H,12-14,16H2,1-3H3,(H,26,28)(H,29,30)/t23-/m0/s1 |
| InChIKey | AVHUNMPAFVVJLW-QHCPKHFHSA-N |
| XLogP | 3.23 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|