C24H28ClNO5S — CID 175407430
N-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl]-N-[(2S)-3-methyl-1-oxobutan-2-yl]methanesulfonamide (PubChem CID 175407430) has the molecular formula C24H28ClNO5S and a molecular weight of 478.01 g/mol. Its IUPAC name is N-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl]-N-[(2S)-3-methyl-1-oxobutan-2-yl]methanesulfonamide.
| Compound Name | N-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl]-N-[(2S)-3-methyl-1-oxobutan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 175407430 |
| Molecular Formula | C24H28ClNO5S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl]-N-[(2S)-3-methyl-1-oxobutan-2-yl]methanesulfonamide |
| SMILES | COc1cc(CCN([C@H](C=O)C(C)C)S(C)(=O)=O)ccc1OCC#Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H28ClNO5S/c1-18(2)22(17-27)26(32(4,28)29)14-13-20-9-12-23(24(16-20)30-3)31-15-5-6-19-7-10-21(25)11-8-19/h7-12,16-18,22H,13-15H2,1-4H3/t22-/m1/s1 |
| InChIKey | YHQRPMJOIQYXPC-JOCHJYFZSA-N |
| XLogP | 3.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|