C25H30ClNO5S — CID 141470644
N-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl]-2-ethylsulfonyl-3-methylbutanamide (PubChem CID 141470644) has the molecular formula C25H30ClNO5S and a molecular weight of 492.04 g/mol. Its IUPAC name is N-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl]-2-ethylsulfonyl-3-methylbutanamide.
| Compound Name | N-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl]-2-ethylsulfonyl-3-methylbutanamide |
|---|---|
| PubChem CID | 141470644 |
| Molecular Formula | C25H30ClNO5S |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | N-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl]-2-ethylsulfonyl-3-methylbutanamide |
| SMILES | CCS(=O)(=O)C(C(=O)NCCc1ccc(OCC#Cc2ccc(Cl)cc2)c(OC)c1)C(C)C |
| InChI | InChI=1S/C25H30ClNO5S/c1-5-33(29,30)24(18(2)3)25(28)27-15-14-20-10-13-22(23(17-20)31-4)32-16-6-7-19-8-11-21(26)12-9-19/h8-13,17-18,24H,5,14-16H2,1-4H3,(H,27,28) |
| InChIKey | SPRUHRVHDBKBBD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|