C21H22ClNO3 — CID 23087643
N-[(4-chlorophenyl)methyl]-3-(3-methoxy-4-prop-2-ynoxyphenyl)-N-methylpropanamide (PubChem CID 23087643) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-(3-methoxy-4-prop-2-ynoxyphenyl)-N-methylpropanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-(3-methoxy-4-prop-2-ynoxyphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 23087643 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-(3-methoxy-4-prop-2-ynoxyphenyl)-N-methylpropanamide |
| SMILES | C#CCOc1ccc(CCC(=O)N(C)Cc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C21H22ClNO3/c1-4-13-26-19-11-7-16(14-20(19)25-3)8-12-21(24)23(2)15-17-5-9-18(22)10-6-17/h1,5-7,9-11,14H,8,12-13,15H2,2-3H3 |
| InChIKey | BJDGSMJLHOBSGJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|