C28H33ClN4O6S2 — CID 87500047
(2S)-2-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl-methylsulfonylamino]-3-methylbutanamide;imidazole-1-carbothioic S-acid (PubChem CID 87500047) has the molecular formula C28H33ClN4O6S2 and a molecular weight of 621.18 g/mol. Its IUPAC name is (2S)-2-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl-methylsulfonylamino]-3-methylbutanamide;imidazole-1-carbothioic S-acid.
| Compound Name | (2S)-2-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl-methylsulfonylamino]-3-methylbutanamide;imidazole-1-carbothioic S-acid |
|---|---|
| PubChem CID | 87500047 |
| Molecular Formula | C28H33ClN4O6S2 |
| Molecular Weight | 621.18 g/mol |
| Exact Mass | 620.15 |
| IUPAC Name | (2S)-2-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl-methylsulfonylamino]-3-methylbutanamide;imidazole-1-carbothioic S-acid |
| SMILES | COc1cc(CCN([C@H](C(N)=O)C(C)C)S(C)(=O)=O)ccc1OCC#Cc1ccc(Cl)cc1.O=C(S)n1ccnc1 |
| InChI | InChI=1S/C24H29ClN2O5S.C4H4N2OS/c1-17(2)23(24(26)28)27(33(4,29)30)14-13-19-9-12-21(22(16-19)31-3)32-15-5-6-18-7-10-20(25)11-8-18;7-4(8)6-2-1-5-3-6/h7-12,16-17,23H,13-15H2,1-4H3,(H2,26,28);1-3H,(H,7,8)/t23-;/m0./s1 |
| InChIKey | NEZYDJJMPRGWJM-BQAIUKQQSA-N |
| XLogP | 3.87 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.18 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|