C24H24N2O5 — CID 70223727
(4S)-4-[2-acetyl-5-(pyrimidin-5-ylmethoxy)phenoxy]-4-(2-methylphenyl)butanoic acid (PubChem CID 70223727) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is (4S)-4-[2-acetyl-5-(pyrimidin-5-ylmethoxy)phenoxy]-4-(2-methylphenyl)butanoic acid.
| Compound Name | (4S)-4-[2-acetyl-5-(pyrimidin-5-ylmethoxy)phenoxy]-4-(2-methylphenyl)butanoic acid |
|---|---|
| PubChem CID | 70223727 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (4S)-4-[2-acetyl-5-(pyrimidin-5-ylmethoxy)phenoxy]-4-(2-methylphenyl)butanoic acid |
| SMILES | CC(=O)c1ccc(OCc2cncnc2)cc1O[C@@H](CCC(=O)O)c1ccccc1C |
| InChI | InChI=1S/C24H24N2O5/c1-16-5-3-4-6-20(16)22(9-10-24(28)29)31-23-11-19(7-8-21(23)17(2)27)30-14-18-12-25-15-26-13-18/h3-8,11-13,15,22H,9-10,14H2,1-2H3,(H,28,29)/t22-/m0/s1 |
| InChIKey | SSVVZISNFVVANF-QFIPXVFZSA-N |
| XLogP | 4.55 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |