C27H29NO5 — CID 54459702
ethyl 4-(2-carbamoyl-5-phenylmethoxyphenoxy)-4-(2-methylphenyl)butanoate (PubChem CID 54459702) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is ethyl 4-(2-carbamoyl-5-phenylmethoxyphenoxy)-4-(2-methylphenyl)butanoate.
| Compound Name | ethyl 4-(2-carbamoyl-5-phenylmethoxyphenoxy)-4-(2-methylphenyl)butanoate |
|---|---|
| PubChem CID | 54459702 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | ethyl 4-(2-carbamoyl-5-phenylmethoxyphenoxy)-4-(2-methylphenyl)butanoate |
| SMILES | CCOC(=O)CCC(Oc1cc(OCc2ccccc2)ccc1C(N)=O)c1ccccc1C |
| InChI | InChI=1S/C27H29NO5/c1-3-31-26(29)16-15-24(22-12-8-7-9-19(22)2)33-25-17-21(13-14-23(25)27(28)30)32-18-20-10-5-4-6-11-20/h4-14,17,24H,3,15-16,18H2,1-2H3,(H2,28,30) |
| InChIKey | XATDKIOAZDUSEU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |