C30H32O6 — CID 67621689
2-ethyl-4-[2-(3-methoxy-3-oxoprop-1-enyl)-5-phenylmethoxyphenoxy]-4-(2-methylphenyl)butanoic acid (PubChem CID 67621689) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-ethyl-4-[2-(3-methoxy-3-oxoprop-1-enyl)-5-phenylmethoxyphenoxy]-4-(2-methylphenyl)butanoic acid.
| Compound Name | 2-ethyl-4-[2-(3-methoxy-3-oxoprop-1-enyl)-5-phenylmethoxyphenoxy]-4-(2-methylphenyl)butanoic acid |
|---|---|
| PubChem CID | 67621689 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 2-ethyl-4-[2-(3-methoxy-3-oxoprop-1-enyl)-5-phenylmethoxyphenoxy]-4-(2-methylphenyl)butanoic acid |
| SMILES | CCC(CC(Oc1cc(OCc2ccccc2)ccc1C=CC(=O)OC)c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C30H32O6/c1-4-23(30(32)33)18-28(26-13-9-8-10-21(26)2)36-27-19-25(35-20-22-11-6-5-7-12-22)16-14-24(27)15-17-29(31)34-3/h5-17,19,23,28H,4,18,20H2,1-3H3,(H,32,33) |
| InChIKey | FSHZMEASQIGMBL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|