C26H30O5S — CID 23204093
ethyl 4-[2-(1-hydroxyethyl)-5-(thiophen-3-ylmethoxy)phenoxy]-4-(2-methylphenyl)butanoate (PubChem CID 23204093) has the molecular formula C26H30O5S and a molecular weight of 454.59 g/mol. Its IUPAC name is ethyl 4-[2-(1-hydroxyethyl)-5-(thiophen-3-ylmethoxy)phenoxy]-4-(2-methylphenyl)butanoate.
| Compound Name | ethyl 4-[2-(1-hydroxyethyl)-5-(thiophen-3-ylmethoxy)phenoxy]-4-(2-methylphenyl)butanoate |
|---|---|
| PubChem CID | 23204093 |
| Molecular Formula | C26H30O5S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | ethyl 4-[2-(1-hydroxyethyl)-5-(thiophen-3-ylmethoxy)phenoxy]-4-(2-methylphenyl)butanoate |
| SMILES | CCOC(=O)CCC(Oc1cc(OCc2ccsc2)ccc1C(C)O)c1ccccc1C |
| InChI | InChI=1S/C26H30O5S/c1-4-29-26(28)12-11-24(22-8-6-5-7-18(22)2)31-25-15-21(9-10-23(25)19(3)27)30-16-20-13-14-32-17-20/h5-10,13-15,17,19,24,27H,4,11-12,16H2,1-3H3 |
| InChIKey | QDBNSKKVGNHPRX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |