C23H22O4S — CID 10692031
(4S)-4-(2-methylphenyl)-5-oxo-5-[3-(thiophen-3-ylmethoxy)phenyl]pentanoic acid (PubChem CID 10692031) has the molecular formula C23H22O4S and a molecular weight of 394.49 g/mol. Its IUPAC name is (4S)-4-(2-methylphenyl)-5-oxo-5-[3-(thiophen-3-ylmethoxy)phenyl]pentanoic acid.
| Compound Name | (4S)-4-(2-methylphenyl)-5-oxo-5-[3-(thiophen-3-ylmethoxy)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 10692031 |
| Molecular Formula | C23H22O4S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (4S)-4-(2-methylphenyl)-5-oxo-5-[3-(thiophen-3-ylmethoxy)phenyl]pentanoic acid |
| SMILES | Cc1ccccc1[C@H](CCC(=O)O)C(=O)c1cccc(OCc2ccsc2)c1 |
| InChI | InChI=1S/C23H22O4S/c1-16-5-2-3-8-20(16)21(9-10-22(24)25)23(26)18-6-4-7-19(13-18)27-14-17-11-12-28-15-17/h2-8,11-13,15,21H,9-10,14H2,1H3,(H,24,25)/t21-/m0/s1 |
| InChIKey | DHSRZCIYOWGXNT-NRFANRHFSA-N |
| XLogP | 5.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |