C27H28O5 — CID 67621388
5-[3-[(3-methoxyphenyl)methoxy]phenyl]-2-methyl-4-(2-methylphenyl)-5-oxopentanoic acid (PubChem CID 67621388) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is 5-[3-[(3-methoxyphenyl)methoxy]phenyl]-2-methyl-4-(2-methylphenyl)-5-oxopentanoic acid.
| Compound Name | 5-[3-[(3-methoxyphenyl)methoxy]phenyl]-2-methyl-4-(2-methylphenyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67621388 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 5-[3-[(3-methoxyphenyl)methoxy]phenyl]-2-methyl-4-(2-methylphenyl)-5-oxopentanoic acid |
| SMILES | COc1cccc(COc2cccc(C(=O)C(CC(C)C(=O)O)c3ccccc3C)c2)c1 |
| InChI | InChI=1S/C27H28O5/c1-18-8-4-5-13-24(18)25(14-19(2)27(29)30)26(28)21-10-7-12-23(16-21)32-17-20-9-6-11-22(15-20)31-3/h4-13,15-16,19,25H,14,17H2,1-3H3,(H,29,30) |
| InChIKey | ZKPUDFLGFMICRC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |