C25H25NO4 — CID 22010320
5-[3-[(3-aminophenyl)methoxy]phenyl]-4-(2-methylphenyl)-5-oxopentanoic acid (PubChem CID 22010320) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 5-[3-[(3-aminophenyl)methoxy]phenyl]-4-(2-methylphenyl)-5-oxopentanoic acid.
| Compound Name | 5-[3-[(3-aminophenyl)methoxy]phenyl]-4-(2-methylphenyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22010320 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 5-[3-[(3-aminophenyl)methoxy]phenyl]-4-(2-methylphenyl)-5-oxopentanoic acid |
| SMILES | Cc1ccccc1C(CCC(=O)O)C(=O)c1cccc(OCc2cccc(N)c2)c1 |
| InChI | InChI=1S/C25H25NO4/c1-17-6-2-3-11-22(17)23(12-13-24(27)28)25(29)19-8-5-10-21(15-19)30-16-18-7-4-9-20(26)14-18/h2-11,14-15,23H,12-13,16,26H2,1H3,(H,27,28) |
| InChIKey | KXGTWFQXWDPLOP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|