C26H26O4 — CID 10668818
methyl 4-(4-methylphenyl)-5-oxo-5-(3-phenylmethoxyphenyl)pentanoate (PubChem CID 10668818) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is methyl 4-(4-methylphenyl)-5-oxo-5-(3-phenylmethoxyphenyl)pentanoate.
| Compound Name | methyl 4-(4-methylphenyl)-5-oxo-5-(3-phenylmethoxyphenyl)pentanoate |
|---|---|
| PubChem CID | 10668818 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | methyl 4-(4-methylphenyl)-5-oxo-5-(3-phenylmethoxyphenyl)pentanoate |
| SMILES | COC(=O)CCC(C(=O)c1cccc(OCc2ccccc2)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H26O4/c1-19-11-13-21(14-12-19)24(15-16-25(27)29-2)26(28)22-9-6-10-23(17-22)30-18-20-7-4-3-5-8-20/h3-14,17,24H,15-16,18H2,1-2H3 |
| InChIKey | CVBHUYRFSDDMJD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |