C25H24O5 — CID 70225759
(4S)-5-[3-[(2-methoxyphenyl)methoxy]phenyl]-5-oxo-4-phenylpentanoic acid (PubChem CID 70225759) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is (4S)-5-[3-[(2-methoxyphenyl)methoxy]phenyl]-5-oxo-4-phenylpentanoic acid.
| Compound Name | (4S)-5-[3-[(2-methoxyphenyl)methoxy]phenyl]-5-oxo-4-phenylpentanoic acid |
|---|---|
| PubChem CID | 70225759 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (4S)-5-[3-[(2-methoxyphenyl)methoxy]phenyl]-5-oxo-4-phenylpentanoic acid |
| SMILES | COc1ccccc1COc1cccc(C(=O)[C@@H](CCC(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H24O5/c1-29-23-13-6-5-10-20(23)17-30-21-12-7-11-19(16-21)25(28)22(14-15-24(26)27)18-8-3-2-4-9-18/h2-13,16,22H,14-15,17H2,1H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | XMNSOEAFDNRXEB-QFIPXVFZSA-N |
| XLogP | 5.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |