C18H17IO3 — CID 22010517
5-(3-iodophenyl)-4-(2-methylphenyl)-5-oxopentanoic acid (PubChem CID 22010517) has the molecular formula C18H17IO3 and a molecular weight of 408.24 g/mol. Its IUPAC name is 5-(3-iodophenyl)-4-(2-methylphenyl)-5-oxopentanoic acid.
| Compound Name | 5-(3-iodophenyl)-4-(2-methylphenyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22010517 |
| Molecular Formula | C18H17IO3 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 5-(3-iodophenyl)-4-(2-methylphenyl)-5-oxopentanoic acid |
| SMILES | Cc1ccccc1C(CCC(=O)O)C(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C18H17IO3/c1-12-5-2-3-8-15(12)16(9-10-17(20)21)18(22)13-6-4-7-14(19)11-13/h2-8,11,16H,9-10H2,1H3,(H,20,21) |
| InChIKey | HAWJVKRRIKSNEF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|