C26H26O4 — CID 70225916
(4S)-4-(2-methylphenyl)-5-(2-methyl-3-phenylmethoxyphenyl)-5-oxopentanoic acid (PubChem CID 70225916) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is (4S)-4-(2-methylphenyl)-5-(2-methyl-3-phenylmethoxyphenyl)-5-oxopentanoic acid.
| Compound Name | (4S)-4-(2-methylphenyl)-5-(2-methyl-3-phenylmethoxyphenyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70225916 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (4S)-4-(2-methylphenyl)-5-(2-methyl-3-phenylmethoxyphenyl)-5-oxopentanoic acid |
| SMILES | Cc1ccccc1[C@H](CCC(=O)O)C(=O)c1cccc(OCc2ccccc2)c1C |
| InChI | InChI=1S/C26H26O4/c1-18-9-6-7-12-21(18)23(15-16-25(27)28)26(29)22-13-8-14-24(19(22)2)30-17-20-10-4-3-5-11-20/h3-14,23H,15-17H2,1-2H3,(H,27,28)/t23-/m0/s1 |
| InChIKey | XBXJYMNXCZDSSM-QHCPKHFHSA-N |
| XLogP | 5.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |