C28H35NO8 — CID 70229977
(E)-but-2-enedioic acid;(3R)-1-[2-[3-(3-methoxyphenyl)-3-phenylpropoxy]ethyl]piperidine-3-carboxylic acid (PubChem CID 70229977) has the molecular formula C28H35NO8 and a molecular weight of 513.59 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(3R)-1-[2-[3-(3-methoxyphenyl)-3-phenylpropoxy]ethyl]piperidine-3-carboxylic acid.
| Compound Name | (E)-but-2-enedioic acid;(3R)-1-[2-[3-(3-methoxyphenyl)-3-phenylpropoxy]ethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70229977 |
| Molecular Formula | C28H35NO8 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | (E)-but-2-enedioic acid;(3R)-1-[2-[3-(3-methoxyphenyl)-3-phenylpropoxy]ethyl]piperidine-3-carboxylic acid |
| SMILES | COc1cccc(C(CCOCCN2CCC[C@@H](C(=O)O)C2)c2ccccc2)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H31NO4.C4H4O4/c1-28-22-11-5-9-20(17-22)23(19-7-3-2-4-8-19)12-15-29-16-14-25-13-6-10-21(18-25)24(26)27;5-3(6)1-2-4(7)8/h2-5,7-9,11,17,21,23H,6,10,12-16,18H2,1H3,(H,26,27);1-2H,(H,5,6)(H,7,8)/b;2-1+/t21-,23?;/m1./s1 |
| InChIKey | TWVLLLRIEPJUHB-LWVFNDBTSA-N |
| XLogP | 3.74 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|