C15H17NO3 — CID 70231499
ethyl 4-[(1S,6R)-2-oxo-3-azabicyclo[4.1.0]heptan-3-yl]benzoate (PubChem CID 70231499) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is ethyl 4-[(1S,6R)-2-oxo-3-azabicyclo[4.1.0]heptan-3-yl]benzoate.
| Compound Name | ethyl 4-[(1S,6R)-2-oxo-3-azabicyclo[4.1.0]heptan-3-yl]benzoate |
|---|---|
| PubChem CID | 70231499 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | ethyl 4-[(1S,6R)-2-oxo-3-azabicyclo[4.1.0]heptan-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CC[C@H]3C[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C15H17NO3/c1-2-19-15(18)10-3-5-12(6-4-10)16-8-7-11-9-13(11)14(16)17/h3-6,11,13H,2,7-9H2,1H3/t11-,13-/m0/s1 |
| InChIKey | LFTLGDHQKCOXJX-AAEUAGOBSA-N |
| XLogP | 2.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |