C24H22F3N5O2 — CID 70232990
[2-[6-(pyridin-2-ylmethoxy)pyridazin-3-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 70232990) has the molecular formula C24H22F3N5O2 and a molecular weight of 469.47 g/mol. Its IUPAC name is [2-[6-(pyridin-2-ylmethoxy)pyridazin-3-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [2-[6-(pyridin-2-ylmethoxy)pyridazin-3-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 70232990 |
| Molecular Formula | C24H22F3N5O2 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | [2-[6-(pyridin-2-ylmethoxy)pyridazin-3-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1C(F)(F)F)N1CC2CN(c3ccc(OCc4ccccn4)nn3)CC2C1 |
| InChI | InChI=1S/C24H22F3N5O2/c25-24(26,27)20-7-2-1-6-19(20)23(33)32-13-16-11-31(12-17(16)14-32)21-8-9-22(30-29-21)34-15-18-5-3-4-10-28-18/h1-10,16-17H,11-15H2 |
| InChIKey | PMSPCUAZLJBILS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |