About ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate
ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate (PubChem CID 70235299) has the molecular formula C24H24N4O2
and a molecular weight of 400.48 g/mol. Its IUPAC name is ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate |
| PubChem CID | 70235299 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CC3C2CN3C(c2ccccc2)c2ccccc2)nc1 |
| InChI | InChI=1S/C24H24N4O2/c1-2-30-23(29)19-13-25-24(26-14-19)28-16-20-21(28)15-27(20)22(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-14,20-22H,2,15-16H2,1H3 |
| InChIKey | DBZPTSHCSAHOHM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate?
The IUPAC name of ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate (CID 70235299) is ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate is CCOC(=O)c1cnc(N2CC3C2CN3C(c2ccccc2)c2ccccc2)nc1.
What is the InChIKey of ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate?
The InChIKey is DBZPTSHCSAHOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O2/c1-2-30-23(29)19-13-25-24(26-14-19)28-16-20-21(28)15-27(20)22(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-14,20-22H,2,15-16H2,1H3.
What are the key properties of ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate?
ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate has a molecular weight of 400.48 g/mol, XLogP of 3.32, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(5-benzhydryl-2,5-diazabicyclo[2.2.0]hexan-2-yl)pyrimidine-5-carboxylate is sourced from PubChem (CID 70235299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).