C28H34Cl2F2N2O4 — CID 70236714
(5S,6R,7S,7aR)-6-amino-7-(3-chloro-2-fluorophenyl)-6-(4-chloro-2-fluorophenyl)-5-[4-(2-hydroxyethoxy)-2,2-dimethylbutyl]-3,3-dimethyl-7,7a-dihydro-5H-pyrrolo[1,2-c][1,3]oxazol-1-one (PubChem CID 70236714) has the molecular formula C28H34Cl2F2N2O4 and a molecular weight of 571.49 g/mol. Its IUPAC name is (5S,6R,7S,7aR)-6-amino-7-(3-chloro-2-fluorophenyl)-6-(4-chloro-2-fluorophenyl)-5-[4-(2-hydroxyethoxy)-2,2-dimethylbutyl]-3,3-dimethyl-7,7a-dihydro-5H-pyrrolo[1,2-c][1,3]oxazol-1-one.
| Compound Name | (5S,6R,7S,7aR)-6-amino-7-(3-chloro-2-fluorophenyl)-6-(4-chloro-2-fluorophenyl)-5-[4-(2-hydroxyethoxy)-2,2-dimethylbutyl]-3,3-dimethyl-7,7a-dihydro-5H-pyrrolo[1,2-c][1,3]oxazol-1-one |
|---|---|
| PubChem CID | 70236714 |
| Molecular Formula | C28H34Cl2F2N2O4 |
| Molecular Weight | 571.49 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | (5S,6R,7S,7aR)-6-amino-7-(3-chloro-2-fluorophenyl)-6-(4-chloro-2-fluorophenyl)-5-[4-(2-hydroxyethoxy)-2,2-dimethylbutyl]-3,3-dimethyl-7,7a-dihydro-5H-pyrrolo[1,2-c][1,3]oxazol-1-one |
| SMILES | CC(C)(CCOCCO)C[C@@H]1N2[C@@H](C(=O)OC2(C)C)[C@H](c2cccc(Cl)c2F)[C@@]1(N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C28H34Cl2F2N2O4/c1-26(2,10-12-37-13-11-35)15-21-28(33,18-9-8-16(29)14-20(18)31)22(17-6-5-7-19(30)23(17)32)24-25(36)38-27(3,4)34(21)24/h5-9,14,21-22,24,35H,10-13,15,33H2,1-4H3/t21-,22-,24+,28+/m0/s1 |
| InChIKey | OQAYAIAGBLQCBR-XGBRHKLLSA-N |
| XLogP | 5.37 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|