C20H26N6O2 — CID 70238003
1-ethyl-4-(4-methoxybutylamino)-N-(pyridin-4-ylmethyl)pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 70238003) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 1-ethyl-4-(4-methoxybutylamino)-N-(pyridin-4-ylmethyl)pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 1-ethyl-4-(4-methoxybutylamino)-N-(pyridin-4-ylmethyl)pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 70238003 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-ethyl-4-(4-methoxybutylamino)-N-(pyridin-4-ylmethyl)pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCn1ncc2c(NCCCCOC)c(C(=O)NCc3ccncc3)cnc21 |
| InChI | InChI=1S/C20H26N6O2/c1-3-26-19-16(14-25-26)18(22-8-4-5-11-28-2)17(13-23-19)20(27)24-12-15-6-9-21-10-7-15/h6-7,9-10,13-14H,3-5,8,11-12H2,1-2H3,(H,22,23)(H,24,27) |
| InChIKey | DOTXUSASZVJFLQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|