C21H26ClN5O3 — CID 70239271
4-[(3-chloro-4-methoxyphenyl)methylamino]-1-ethyl-N-(4-hydroxybutyl)pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 70239271) has the molecular formula C21H26ClN5O3 and a molecular weight of 431.92 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)methylamino]-1-ethyl-N-(4-hydroxybutyl)pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-1-ethyl-N-(4-hydroxybutyl)pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 70239271 |
| Molecular Formula | C21H26ClN5O3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-1-ethyl-N-(4-hydroxybutyl)pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCn1ncc2c(NCc3ccc(OC)c(Cl)c3)c(C(=O)NCCCCO)cnc21 |
| InChI | InChI=1S/C21H26ClN5O3/c1-3-27-20-15(13-26-27)19(16(12-25-20)21(29)23-8-4-5-9-28)24-11-14-6-7-18(30-2)17(22)10-14/h6-7,10,12-13,28H,3-5,8-9,11H2,1-2H3,(H,23,29)(H,24,25) |
| InChIKey | RBBKWSCTSMTVJV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|