C20H24ClN5O3 — CID 70239856
4-[(3-chloro-4-methoxyphenyl)methylamino]-1-ethyl-N-(3-hydroxypropyl)pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 70239856) has the molecular formula C20H24ClN5O3 and a molecular weight of 417.90 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)methylamino]-1-ethyl-N-(3-hydroxypropyl)pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-1-ethyl-N-(3-hydroxypropyl)pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 70239856 |
| Molecular Formula | C20H24ClN5O3 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-1-ethyl-N-(3-hydroxypropyl)pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCn1ncc2c(NCc3ccc(OC)c(Cl)c3)c(C(=O)NCCCO)cnc21 |
| InChI | InChI=1S/C20H24ClN5O3/c1-3-26-19-14(12-25-26)18(15(11-24-19)20(28)22-7-4-8-27)23-10-13-5-6-17(29-2)16(21)9-13/h5-6,9,11-12,27H,3-4,7-8,10H2,1-2H3,(H,22,28)(H,23,24) |
| InChIKey | UUFXTWRMWOPIKN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|