C18H18ClN7O — CID 20703348
13-N-[(3-chloro-4-methoxyphenyl)methyl]-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaene-10,13-diamine (PubChem CID 20703348) has the molecular formula C18H18ClN7O and a molecular weight of 383.84 g/mol. Its IUPAC name is 13-N-[(3-chloro-4-methoxyphenyl)methyl]-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaene-10,13-diamine.
| Compound Name | 13-N-[(3-chloro-4-methoxyphenyl)methyl]-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaene-10,13-diamine |
|---|---|
| PubChem CID | 20703348 |
| Molecular Formula | C18H18ClN7O |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 13-N-[(3-chloro-4-methoxyphenyl)methyl]-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaene-10,13-diamine |
| SMILES | CCn1ncc2c3c(NCc4ccc(OC)c(Cl)c4)nnc(N)c3cnc21 |
| InChI | InChI=1S/C18H18ClN7O/c1-3-26-18-12(9-23-26)15-11(8-22-18)16(20)24-25-17(15)21-7-10-4-5-14(27-2)13(19)6-10/h4-6,8-9H,3,7H2,1-2H3,(H2,20,24)(H,21,25) |
| InChIKey | SATGZSAJYAUGDP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |