C24H23ClN8O2 — CID 70241605
8-[(3-chloro-4-methoxyphenyl)methyl]-5-ethyl-10-N-[(1-oxidopyridin-1-ium-4-yl)methyl]-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaene-10,13-diamine (PubChem CID 70241605) has the molecular formula C24H23ClN8O2 and a molecular weight of 490.96 g/mol. Its IUPAC name is 8-[(3-chloro-4-methoxyphenyl)methyl]-5-ethyl-10-N-[(1-oxidopyridin-1-ium-4-yl)methyl]-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaene-10,13-diamine.
| Compound Name | 8-[(3-chloro-4-methoxyphenyl)methyl]-5-ethyl-10-N-[(1-oxidopyridin-1-ium-4-yl)methyl]-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaene-10,13-diamine |
|---|---|
| PubChem CID | 70241605 |
| Molecular Formula | C24H23ClN8O2 |
| Molecular Weight | 490.96 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 8-[(3-chloro-4-methoxyphenyl)methyl]-5-ethyl-10-N-[(1-oxidopyridin-1-ium-4-yl)methyl]-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaene-10,13-diamine |
| SMILES | CCn1ncc2c3c(N)nnc(NCc4cc[n+]([O-])cc4)c3c(Cc3ccc(OC)c(Cl)c3)nc21 |
| InChI | InChI=1S/C24H23ClN8O2/c1-3-33-24-16(13-28-33)20-21(18(29-24)11-15-4-5-19(35-2)17(25)10-15)23(31-30-22(20)26)27-12-14-6-8-32(34)9-7-14/h4-10,13H,3,11-12H2,1-2H3,(H2,26,30)(H,27,31) |
| InChIKey | BLUUKDCWZXWFDA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.96 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|