C14H26N3O+ — CID 70239367
[3-hydroxy-3-(2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)propyl]-trimethylazanium (PubChem CID 70239367) has the molecular formula C14H26N3O+ and a molecular weight of 252.38 g/mol. Its IUPAC name is [3-hydroxy-3-(2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)propyl]-trimethylazanium.
| Compound Name | [3-hydroxy-3-(2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 70239367 |
| Molecular Formula | C14H26N3O+ |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | [3-hydroxy-3-(2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)propyl]-trimethylazanium |
| SMILES | Cc1nn2c(c1C(O)CC[N+](C)(C)C)CCCC2 |
| InChI | InChI=1S/C14H26N3O/c1-11-14(13(18)8-10-17(2,3)4)12-7-5-6-9-16(12)15-11/h13,18H,5-10H2,1-4H3/q+1 |
| InChIKey | WVGNNNHHDWTHNF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|