C21H32BrN3O4 — CID 70240919
[(2R)-1-[4-[3-(4-bromophenoxy)propyl]piperazin-1-yl]-1-oxopropan-2-yl]-tert-butylcarbamic acid (PubChem CID 70240919) has the molecular formula C21H32BrN3O4 and a molecular weight of 470.41 g/mol. Its IUPAC name is [(2R)-1-[4-[3-(4-bromophenoxy)propyl]piperazin-1-yl]-1-oxopropan-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(2R)-1-[4-[3-(4-bromophenoxy)propyl]piperazin-1-yl]-1-oxopropan-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 70240919 |
| Molecular Formula | C21H32BrN3O4 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [(2R)-1-[4-[3-(4-bromophenoxy)propyl]piperazin-1-yl]-1-oxopropan-2-yl]-tert-butylcarbamic acid |
| SMILES | C[C@H](C(=O)N1CCN(CCCOc2ccc(Br)cc2)CC1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C21H32BrN3O4/c1-16(25(20(27)28)21(2,3)4)19(26)24-13-11-23(12-14-24)10-5-15-29-18-8-6-17(22)7-9-18/h6-9,16H,5,10-15H2,1-4H3,(H,27,28)/t16-/m1/s1 |
| InChIKey | JXTYEMZGKQHASE-MRXNPFEDSA-N |
| XLogP | 3.53 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|