C16H28N2O2+2 — CID 7024099
[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl-[(2S)-2-hydroxy-3-phenoxypropyl]azanium (PubChem CID 7024099) has the molecular formula C16H28N2O2+2 and a molecular weight of 280.41 g/mol. Its IUPAC name is [(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl-[(2S)-2-hydroxy-3-phenoxypropyl]azanium.
| Compound Name | [(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl-[(2S)-2-hydroxy-3-phenoxypropyl]azanium |
|---|---|
| PubChem CID | 7024099 |
| Molecular Formula | C16H28N2O2+2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | [(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl-[(2S)-2-hydroxy-3-phenoxypropyl]azanium |
| SMILES | CC[NH+]1CCC[C@H]1C[NH2+]C[C@H](O)COc1ccccc1 |
| InChI | InChI=1S/C16H26N2O2/c1-2-18-10-6-7-14(18)11-17-12-15(19)13-20-16-8-4-3-5-9-16/h3-5,8-9,14-15,17,19H,2,6-7,10-13H2,1H3/p+2/t14-,15-/m0/s1 |
| InChIKey | MYZHMUCEOWWVOD-GJZGRUSLSA-P |
| XLogP | -0.94 |
| TPSA | 50.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |