C27H31N3O3S — CID 70242111
ethyl 2-[2-[4-[(3-hydroxyphenyl)-(4-prop-2-enylpiperazin-1-yl)methyl]phenyl]-1,3-thiazol-4-yl]acetate (PubChem CID 70242111) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is ethyl 2-[2-[4-[(3-hydroxyphenyl)-(4-prop-2-enylpiperazin-1-yl)methyl]phenyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[4-[(3-hydroxyphenyl)-(4-prop-2-enylpiperazin-1-yl)methyl]phenyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 70242111 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | ethyl 2-[2-[4-[(3-hydroxyphenyl)-(4-prop-2-enylpiperazin-1-yl)methyl]phenyl]-1,3-thiazol-4-yl]acetate |
| SMILES | C=CCN1CCN(C(c2ccc(-c3nc(CC(=O)OCC)cs3)cc2)c2cccc(O)c2)CC1 |
| InChI | InChI=1S/C27H31N3O3S/c1-3-12-29-13-15-30(16-14-29)26(22-6-5-7-24(31)17-22)20-8-10-21(11-9-20)27-28-23(19-34-27)18-25(32)33-4-2/h3,5-11,17,19,26,31H,1,4,12-16,18H2,2H3 |
| InChIKey | XPYNKFHNPOGDEK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|