About ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate
ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 70248872) has the molecular formula C16H24O4S
and a molecular weight of 312.43 g/mol. Its IUPAC name is ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| PubChem CID | 70248872 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1C2C=CC(S2)C1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24O4S/c1-15(2,3)19-13(17)11-9-7-8-10(21-9)12(11)14(18)20-16(4,5)6/h7-12H,1-6H3 |
| InChIKey | KWMRZTJPWITNJP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The IUPAC name of ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (CID 70248872) is ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
What is the SMILES notation for ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The canonical SMILES for ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate is CC(C)(C)OC(=O)C1C2C=CC(S2)C1C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The InChIKey is KWMRZTJPWITNJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O4S/c1-15(2,3)19-13(17)11-9-7-8-10(21-9)12(11)14(18)20-16(4,5)6/h7-12H,1-6H3.
What are the key properties of ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate has a molecular weight of 312.43 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 7-thiabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate is sourced from PubChem (CID 70248872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).