C22H17NO7 — CID 70250506
(E)-3-[4-[2-[4-(5-methoxycarbonyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]-2-oxoacetyl]phenyl]prop-2-enoic acid (PubChem CID 70250506) has the molecular formula C22H17NO7 and a molecular weight of 407.38 g/mol. Its IUPAC name is (E)-3-[4-[2-[4-(5-methoxycarbonyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]-2-oxoacetyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-[4-(5-methoxycarbonyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]-2-oxoacetyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70250506 |
| Molecular Formula | C22H17NO7 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (E)-3-[4-[2-[4-(5-methoxycarbonyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]-2-oxoacetyl]phenyl]prop-2-enoic acid |
| SMILES | COC(=O)C1CC(c2ccc(C(=O)C(=O)c3ccc(/C=C/C(=O)O)cc3)cc2)=NO1 |
| InChI | InChI=1S/C22H17NO7/c1-29-22(28)18-12-17(23-30-18)14-7-9-16(10-8-14)21(27)20(26)15-5-2-13(3-6-15)4-11-19(24)25/h2-11,18H,12H2,1H3,(H,24,25)/b11-4+ |
| InChIKey | DYYVNDCJNYPFKR-NYYWCZLTSA-N |
| XLogP | 2.52 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|