C39H34N4O6 — CID 70249230
4-[4-[4-(5-methoxycarbonyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]-5-[4-[(E)-3-oxo-3-(3-phenylpropylamino)prop-1-enyl]phenyl]-1H-imidazol-2-yl]benzoic acid (PubChem CID 70249230) has the molecular formula C39H34N4O6 and a molecular weight of 654.72 g/mol. Its IUPAC name is 4-[4-[4-(5-methoxycarbonyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]-5-[4-[(E)-3-oxo-3-(3-phenylpropylamino)prop-1-enyl]phenyl]-1H-imidazol-2-yl]benzoic acid.
| Compound Name | 4-[4-[4-(5-methoxycarbonyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]-5-[4-[(E)-3-oxo-3-(3-phenylpropylamino)prop-1-enyl]phenyl]-1H-imidazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 70249230 |
| Molecular Formula | C39H34N4O6 |
| Molecular Weight | 654.72 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | 4-[4-[4-(5-methoxycarbonyl-4,5-dihydro-1,2-oxazol-3-yl)phenyl]-5-[4-[(E)-3-oxo-3-(3-phenylpropylamino)prop-1-enyl]phenyl]-1H-imidazol-2-yl]benzoic acid |
| SMILES | COC(=O)C1CC(c2ccc(-c3nc(-c4ccc(C(=O)O)cc4)[nH]c3-c3ccc(/C=C/C(=O)NCCCc4ccccc4)cc3)cc2)=NO1 |
| InChI | InChI=1S/C39H34N4O6/c1-48-39(47)33-24-32(43-49-33)27-14-16-29(17-15-27)36-35(41-37(42-36)30-18-20-31(21-19-30)38(45)46)28-12-9-26(10-13-28)11-22-34(44)40-23-5-8-25-6-3-2-4-7-25/h2-4,6-7,9-22,33H,5,8,23-24H2,1H3,(H,40,44)(H,41,42)(H,45,46)/b22-11+ |
| InChIKey | HOTSHXPBTZCTOU-SSDVNMTOSA-N |
| XLogP | 6.54 |
| TPSA | 142.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|