C38H38N4O6 — CID 70251658
(3R)-3-[[(2S)-3-(1H-indol-3-yl)-1-oxo-1-(2-phenylethylamino)propan-2-yl]carbamoyl]-6-[4-(4-nitrophenyl)phenyl]hexanoic acid (PubChem CID 70251658) has the molecular formula C38H38N4O6 and a molecular weight of 646.74 g/mol. Its IUPAC name is (3R)-3-[[(2S)-3-(1H-indol-3-yl)-1-oxo-1-(2-phenylethylamino)propan-2-yl]carbamoyl]-6-[4-(4-nitrophenyl)phenyl]hexanoic acid.
| Compound Name | (3R)-3-[[(2S)-3-(1H-indol-3-yl)-1-oxo-1-(2-phenylethylamino)propan-2-yl]carbamoyl]-6-[4-(4-nitrophenyl)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 70251658 |
| Molecular Formula | C38H38N4O6 |
| Molecular Weight | 646.74 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | (3R)-3-[[(2S)-3-(1H-indol-3-yl)-1-oxo-1-(2-phenylethylamino)propan-2-yl]carbamoyl]-6-[4-(4-nitrophenyl)phenyl]hexanoic acid |
| SMILES | O=C(O)C[C@@H](CCCc1ccc(-c2ccc([N+](=O)[O-])cc2)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C38H38N4O6/c43-36(44)24-30(10-6-9-27-13-15-28(16-14-27)29-17-19-32(20-18-29)42(47)48)37(45)41-35(23-31-25-40-34-12-5-4-11-33(31)34)38(46)39-22-21-26-7-2-1-3-8-26/h1-5,7-8,11-20,25,30,35,40H,6,9-10,21-24H2,(H,39,46)(H,41,45)(H,43,44)/t30-,35+/m1/s1 |
| InChIKey | KBDIPCXQSWTPRN-BIMVPBQRSA-N |
| XLogP | 6.24 |
| TPSA | 154.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.74 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|