C37H61N3O10 — CID 70253619
benzyl 3-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-4-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethylamino]butanoate (PubChem CID 70253619) has the molecular formula C37H61N3O10 and a molecular weight of 707.91 g/mol. Its IUPAC name is benzyl 3-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-4-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethylamino]butanoate.
| Compound Name | benzyl 3-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-4-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethylamino]butanoate |
|---|---|
| PubChem CID | 70253619 |
| Molecular Formula | C37H61N3O10 |
| Molecular Weight | 707.91 g/mol |
| Exact Mass | 707.44 |
| IUPAC Name | benzyl 3-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-4-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)CN(CCNCC(CC(=O)OCc1ccccc1)N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H61N3O10/c1-34(2,3)47-30(42)22-39(23-31(43)48-35(4,5)6)19-18-38-21-28(20-29(41)46-26-27-16-14-13-15-17-27)40(24-32(44)49-36(7,8)9)25-33(45)50-37(10,11)12/h13-17,28,38H,18-26H2,1-12H3 |
| InChIKey | QLFZDACKSISHCO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 150.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|