C25H40O7 — CID 70255117
(3R,5R)-7-[(1S,2S,6S,8S,8aR)-6-(hydroxymethyl)-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxy-2-methylheptanoic acid (PubChem CID 70255117) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is (3R,5R)-7-[(1S,2S,6S,8S,8aR)-6-(hydroxymethyl)-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxy-2-methylheptanoic acid.
| Compound Name | (3R,5R)-7-[(1S,2S,6S,8S,8aR)-6-(hydroxymethyl)-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxy-2-methylheptanoic acid |
|---|---|
| PubChem CID | 70255117 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | (3R,5R)-7-[(1S,2S,6S,8S,8aR)-6-(hydroxymethyl)-2-methyl-8-(2-methylbutanoyloxy)-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxy-2-methylheptanoic acid |
| SMILES | CCC(C)C(=O)O[C@H]1C[C@H](CO)C=C2C=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)C(C)C(=O)O)[C@H]21 |
| InChI | InChI=1S/C25H40O7/c1-5-14(2)25(31)32-22-11-17(13-26)10-18-7-6-15(3)20(23(18)22)9-8-19(27)12-21(28)16(4)24(29)30/h6-7,10,14-17,19-23,26-28H,5,8-9,11-13H2,1-4H3,(H,29,30)/t14?,15-,16?,17+,19+,20-,21+,22-,23-/m0/s1 |
| InChIKey | VZXOOXHUZRSXQY-WKWLKZPFSA-N |
| XLogP | 2.93 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |