C27H44O7 — CID 144664511
(3R,5R)-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-2-tert-butyl-3,5-dihydroxyheptanoic acid (PubChem CID 144664511) has the molecular formula C27H44O7 and a molecular weight of 480.64 g/mol. Its IUPAC name is (3R,5R)-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-2-tert-butyl-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-2-tert-butyl-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 144664511 |
| Molecular Formula | C27H44O7 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | (3R,5R)-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-2-tert-butyl-3,5-dihydroxyheptanoic acid |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@H](O)C=C2C=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)C(C(=O)O)C(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C27H44O7/c1-7-15(2)26(33)34-22-14-19(29)12-17-9-8-16(3)20(23(17)22)11-10-18(28)13-21(30)24(25(31)32)27(4,5)6/h8-9,12,15-16,18-24,28-30H,7,10-11,13-14H2,1-6H3,(H,31,32)/t15-,16-,18+,19+,20-,21+,22-,23-,24?/m0/s1 |
| InChIKey | ISJIMBRTYDEZAA-FWBQRXMNSA-N |
| XLogP | 3.71 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |