C28H41NO4 — CID 70255676
(3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-8-(3,4,5-trimethoxyphenyl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 70255676) has the molecular formula C28H41NO4 and a molecular weight of 455.64 g/mol. Its IUPAC name is (3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-8-(3,4,5-trimethoxyphenyl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-8-(3,4,5-trimethoxyphenyl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 70255676 |
| Molecular Formula | C28H41NO4 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | (3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-8-(3,4,5-trimethoxyphenyl)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | COc1cc(C2C[C@]3(C)[C@H]4CC[C@]5(C)CCC[C@H]5[C@@H]4CC[C@H]3N(C)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C28H41NO4/c1-27-12-7-8-20(27)18-9-10-24-28(2,21(18)11-13-27)16-19(26(30)29(24)3)17-14-22(31-4)25(33-6)23(15-17)32-5/h14-15,18-21,24H,7-13,16H2,1-6H3/t18-,19?,20-,21-,24+,27-,28+/m0/s1 |
| InChIKey | WHUXJYPRYHYBNJ-KZRVQCAGSA-N |
| XLogP | 5.66 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |