C29H43NO — CID 70257280
(3aS,3bS,5aR,9aR,9bS,11aS)-8-(2-tert-butylphenyl)-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 70257280) has the molecular formula C29H43NO and a molecular weight of 421.67 g/mol. Its IUPAC name is (3aS,3bS,5aR,9aR,9bS,11aS)-8-(2-tert-butylphenyl)-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,5aR,9aR,9bS,11aS)-8-(2-tert-butylphenyl)-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 70257280 |
| Molecular Formula | C29H43NO |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.33 |
| IUPAC Name | (3aS,3bS,5aR,9aR,9bS,11aS)-8-(2-tert-butylphenyl)-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)C(c2ccccc2C(C)(C)C)C[C@]2(C)[C@H]3CC[C@]4(C)CCC[C@H]4[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C29H43NO/c1-27(2,3)22-11-8-7-10-19(22)21-18-29(5)24-15-17-28(4)16-9-12-23(28)20(24)13-14-25(29)30(6)26(21)31/h7-8,10-11,20-21,23-25H,9,12-18H2,1-6H3/t20-,21?,23-,24-,25+,28-,29+/m0/s1 |
| InChIKey | LBGDHQIMHQRNLR-JAOPZXHNSA-N |
| XLogP | 6.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |