C18H24O4 — CID 70257743
2-ethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenylpent-4-enoic acid (PubChem CID 70257743) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-ethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenylpent-4-enoic acid.
| Compound Name | 2-ethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 70257743 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-ethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenylpent-4-enoic acid |
| SMILES | C=C(CC(CC)(C(=O)O)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24O4/c1-6-18(16(20)21,14-10-8-7-9-11-14)12-13(2)15(19)22-17(3,4)5/h7-11H,2,6,12H2,1,3-5H3,(H,20,21) |
| InChIKey | HSCWXTMCSKSNFA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|