C20H24O8 — CID 139695204
3-O-tert-butyl 1-O,1-O-dimethyl 1-O-phenyl but-3-ene-1,1,1,3-tetracarboxylate (PubChem CID 139695204) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O,1-O-dimethyl 1-O-phenyl but-3-ene-1,1,1,3-tetracarboxylate.
| Compound Name | 3-O-tert-butyl 1-O,1-O-dimethyl 1-O-phenyl but-3-ene-1,1,1,3-tetracarboxylate |
|---|---|
| PubChem CID | 139695204 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3-O-tert-butyl 1-O,1-O-dimethyl 1-O-phenyl but-3-ene-1,1,1,3-tetracarboxylate |
| SMILES | C=C(CC(C(=O)OC)(C(=O)OC)C(=O)Oc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H24O8/c1-13(15(21)28-19(2,3)4)12-20(16(22)25-5,17(23)26-6)18(24)27-14-10-8-7-9-11-14/h7-11H,1,12H2,2-6H3 |
| InChIKey | GHFPYCVBHGGYKZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|