C19H22O8 — CID 139695206
1-O,1-O-dimethyl 1-O-phenyl 3-O-propan-2-yl but-3-ene-1,1,1,3-tetracarboxylate (PubChem CID 139695206) has the molecular formula C19H22O8 and a molecular weight of 378.38 g/mol. Its IUPAC name is 1-O,1-O-dimethyl 1-O-phenyl 3-O-propan-2-yl but-3-ene-1,1,1,3-tetracarboxylate.
| Compound Name | 1-O,1-O-dimethyl 1-O-phenyl 3-O-propan-2-yl but-3-ene-1,1,1,3-tetracarboxylate |
|---|---|
| PubChem CID | 139695206 |
| Molecular Formula | C19H22O8 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-O,1-O-dimethyl 1-O-phenyl 3-O-propan-2-yl but-3-ene-1,1,1,3-tetracarboxylate |
| SMILES | C=C(CC(C(=O)OC)(C(=O)OC)C(=O)Oc1ccccc1)C(=O)OC(C)C |
| InChI | InChI=1S/C19H22O8/c1-12(2)26-15(20)13(3)11-19(16(21)24-4,17(22)25-5)18(23)27-14-9-7-6-8-10-14/h6-10,12H,3,11H2,1-2,4-5H3 |
| InChIKey | NRSJWPOTEJBDIA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|