C20H18O6 — CID 158672507
3-[1-(4-methylphenyl)-2-oxo-2-phenoxyethoxy]carbonylbut-3-enoic acid (PubChem CID 158672507) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is 3-[1-(4-methylphenyl)-2-oxo-2-phenoxyethoxy]carbonylbut-3-enoic acid.
| Compound Name | 3-[1-(4-methylphenyl)-2-oxo-2-phenoxyethoxy]carbonylbut-3-enoic acid |
|---|---|
| PubChem CID | 158672507 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 3-[1-(4-methylphenyl)-2-oxo-2-phenoxyethoxy]carbonylbut-3-enoic acid |
| SMILES | C=C(CC(=O)O)C(=O)OC(C(=O)Oc1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H18O6/c1-13-8-10-15(11-9-13)18(26-19(23)14(2)12-17(21)22)20(24)25-16-6-4-3-5-7-16/h3-11,18H,2,12H2,1H3,(H,21,22) |
| InChIKey | IECUMJWKAKXXCF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|