C24H20O5 — CID 161072463
3-[2-(4-methylphenyl)-1-naphthalen-1-yl-2-oxoethoxy]carbonylbut-3-enoic acid (PubChem CID 161072463) has the molecular formula C24H20O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is 3-[2-(4-methylphenyl)-1-naphthalen-1-yl-2-oxoethoxy]carbonylbut-3-enoic acid.
| Compound Name | 3-[2-(4-methylphenyl)-1-naphthalen-1-yl-2-oxoethoxy]carbonylbut-3-enoic acid |
|---|---|
| PubChem CID | 161072463 |
| Molecular Formula | C24H20O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 3-[2-(4-methylphenyl)-1-naphthalen-1-yl-2-oxoethoxy]carbonylbut-3-enoic acid |
| SMILES | C=C(CC(=O)O)C(=O)OC(C(=O)c1ccc(C)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H20O5/c1-15-10-12-18(13-11-15)22(27)23(29-24(28)16(2)14-21(25)26)20-9-5-7-17-6-3-4-8-19(17)20/h3-13,23H,2,14H2,1H3,(H,25,26) |
| InChIKey | UEVKXGLZFUPFDZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|