C34H41N4O6+ — CID 70260096
[2-[(3-carboxyphenyl)carbamoylamino]acetyl]-cyclohexyl-methyl-[2-[2-oxo-2-(N,3,5-trimethylanilino)ethoxy]phenyl]azanium (PubChem CID 70260096) has the molecular formula C34H41N4O6+ and a molecular weight of 601.72 g/mol. Its IUPAC name is [2-[(3-carboxyphenyl)carbamoylamino]acetyl]-cyclohexyl-methyl-[2-[2-oxo-2-(N,3,5-trimethylanilino)ethoxy]phenyl]azanium.
| Compound Name | [2-[(3-carboxyphenyl)carbamoylamino]acetyl]-cyclohexyl-methyl-[2-[2-oxo-2-(N,3,5-trimethylanilino)ethoxy]phenyl]azanium |
|---|---|
| PubChem CID | 70260096 |
| Molecular Formula | C34H41N4O6+ |
| Molecular Weight | 601.72 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | [2-[(3-carboxyphenyl)carbamoylamino]acetyl]-cyclohexyl-methyl-[2-[2-oxo-2-(N,3,5-trimethylanilino)ethoxy]phenyl]azanium |
| SMILES | Cc1cc(C)cc(N(C)C(=O)COc2ccccc2[N+](C)(C(=O)CNC(=O)Nc2cccc(C(=O)O)c2)C2CCCCC2)c1 |
| InChI | InChI=1S/C34H40N4O6/c1-23-17-24(2)19-27(18-23)37(3)31(39)22-44-30-16-9-8-15-29(30)38(4,28-13-6-5-7-14-28)32(40)21-35-34(43)36-26-12-10-11-25(20-26)33(41)42/h8-12,15-20,28H,5-7,13-14,21-22H2,1-4H3,(H2-,35,36,41,42,43)/p+1 |
| InChIKey | YOWTZLPCIAHXMB-UHFFFAOYSA-O |
| XLogP | 5.66 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|